C17H30N4O3 — CID 50974265
1-[(3aR,6aR)-3a-(4-propylpiperazine-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone (PubChem CID 50974265) has the molecular formula C17H30N4O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[(3aR,6aR)-3a-(4-propylpiperazine-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone.
| Compound Name | 1-[(3aR,6aR)-3a-(4-propylpiperazine-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 50974265 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | 1-[(3aR,6aR)-3a-(4-propylpiperazine-1-carbonyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methoxyethanone |
| SMILES | CCCN1CCN(C(=O)[C@@]23CNC[C@@H]2CN(C(=O)COC)C3)CC1 |
| InChI | InChI=1S/C17H30N4O3/c1-3-4-19-5-7-20(8-6-19)16(23)17-12-18-9-14(17)10-21(13-17)15(22)11-24-2/h14,18H,3-13H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | FQOLDXOOIKDRCG-RHSMWYFYSA-N |
| XLogP | -0.76 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |