About N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide
N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 50974363) has the molecular formula C15H22N4OS
and a molecular weight of 306.44 g/mol. Its IUPAC name is N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 50974363 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCc1c(C)nn(CCNC(=O)Cc2csc(C)n2)c1C |
| InChI | InChI=1S/C15H22N4OS/c1-5-14-10(2)18-19(11(14)3)7-6-16-15(20)8-13-9-21-12(4)17-13/h9H,5-8H2,1-4H3,(H,16,20) |
| InChIKey | UFHQNJQPFXHSSM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (CID 50974363) is N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide is CCc1c(C)nn(CCNC(=O)Cc2csc(C)n2)c1C.
What is the InChIKey of N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide?
The InChIKey is UFHQNJQPFXHSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4OS/c1-5-14-10(2)18-19(11(14)3)7-6-16-15(20)8-13-9-21-12(4)17-13/h9H,5-8H2,1-4H3,(H,16,20).
What are the key properties of N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide?
N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide has a molecular weight of 306.44 g/mol, XLogP of 2.19, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 50974363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).