About N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine
N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine (PubChem CID 50974480) has the molecular formula C14H26N4
and a molecular weight of 250.39 g/mol. Its IUPAC name is N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 50974480 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine |
| SMILES | Cc1[nH]cnc1CN(C)CCN(C)C1CCCC1 |
| InChI | InChI=1S/C14H26N4/c1-12-14(16-11-15-12)10-17(2)8-9-18(3)13-6-4-5-7-13/h11,13H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | FIDMZUIWFFTHFL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine (CID 50974480) is N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine is Cc1[nH]cnc1CN(C)CCN(C)C1CCCC1.
What is the InChIKey of N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine?
The InChIKey is FIDMZUIWFFTHFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4/c1-12-14(16-11-15-12)10-17(2)8-9-18(3)13-6-4-5-7-13/h11,13H,4-10H2,1-3H3,(H,15,16).
What are the key properties of N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine?
N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine has a molecular weight of 250.39 g/mol, XLogP of 2.02, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-N,N'-dimethyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 50974480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).