C15H22ClN5O2 — CID 50974828
2-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 50974828) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is 2-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 50974828 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CCCCc1nc(Cl)c(CN2CCN3C(=O)CNC(=O)C3C2)[nH]1 |
| InChI | InChI=1S/C15H22ClN5O2/c1-2-3-4-12-18-10(14(16)19-12)8-20-5-6-21-11(9-20)15(23)17-7-13(21)22/h11H,2-9H2,1H3,(H,17,23)(H,18,19) |
| InChIKey | VZWOYIPUUKRNHA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |