C21H26N4O2 — CID 50974890
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-N-(2-methoxy-3-pyridinyl)benzamide (PubChem CID 50974890) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-N-(2-methoxy-3-pyridinyl)benzamide.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-N-(2-methoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 50974890 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-N-(2-methoxy-3-pyridinyl)benzamide |
| SMILES | COc1ncccc1NC(=O)c1ccc(CN2CCN3CCCC3C2)cc1 |
| InChI | InChI=1S/C21H26N4O2/c1-27-21-19(5-2-10-22-21)23-20(26)17-8-6-16(7-9-17)14-24-12-13-25-11-3-4-18(25)15-24/h2,5-10,18H,3-4,11-15H2,1H3,(H,23,26) |
| InChIKey | GGBMCTMPZDKWPL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |