C13H21N5 — CID 50975125
N-methyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-(3-propyl-1H-pyrazol-5-yl)methanamine (PubChem CID 50975125) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-(3-propyl-1H-pyrazol-5-yl)methanamine.
| Compound Name | N-methyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-(3-propyl-1H-pyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 50975125 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-methyl-N-[(5-methyl-1H-imidazol-4-yl)methyl]-1-(3-propyl-1H-pyrazol-5-yl)methanamine |
| SMILES | CCCc1cc(CN(C)Cc2nc[nH]c2C)[nH]n1 |
| InChI | InChI=1S/C13H21N5/c1-4-5-11-6-12(17-16-11)7-18(3)8-13-10(2)14-9-15-13/h6,9H,4-5,7-8H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | YCTLBNXGQNMAGJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |