C16H17N7O — CID 50975620
7,7-dimethyl-2-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one (PubChem CID 50975620) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is 7,7-dimethyl-2-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one.
| Compound Name | 7,7-dimethyl-2-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
|---|---|
| PubChem CID | 50975620 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 7,7-dimethyl-2-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
| SMILES | CC1(C)CNC(=O)c2nc(-c3cccnc3-n3cncn3)[nH]c2C1 |
| InChI | InChI=1S/C16H17N7O/c1-16(2)6-11-12(15(24)19-7-16)22-13(21-11)10-4-3-5-18-14(10)23-9-17-8-20-23/h3-5,8-9H,6-7H2,1-2H3,(H,19,24)(H,21,22) |
| InChIKey | IWOCZMFWBWGCFX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |