C18H28N2O — CID 50975791
N-[2-(1-but-2-ynyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclohexanecarboxamide (PubChem CID 50975791) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[2-(1-but-2-ynyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(1-but-2-ynyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 50975791 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[2-(1-but-2-ynyl-3,6-dihydro-2H-pyridin-5-yl)ethyl]cyclohexanecarboxamide |
| SMILES | CC#CCN1CCC=C(CCNC(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C18H28N2O/c1-2-3-13-20-14-7-8-16(15-20)11-12-19-18(21)17-9-5-4-6-10-17/h8,17H,4-7,9-15H2,1H3,(H,19,21) |
| InChIKey | LHICDBKJLRXXAK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|