C14H18N4O3S — CID 50975867
N-[(7R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-propan-2-yl-1,3-thiazole-2-carboxamide (PubChem CID 50975867) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[(7R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-propan-2-yl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(7R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-propan-2-yl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 50975867 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[(7R,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-propan-2-yl-1,3-thiazole-2-carboxamide |
| SMILES | CC(C)c1csc(C(=O)N[C@@H]2C[C@H]3C(=O)NCC(=O)N3C2)n1 |
| InChI | InChI=1S/C14H18N4O3S/c1-7(2)9-6-22-14(17-9)13(21)16-8-3-10-12(20)15-4-11(19)18(10)5-8/h6-8,10H,3-5H2,1-2H3,(H,15,20)(H,16,21)/t8-,10+/m1/s1 |
| InChIKey | FOLFDWKRRTUQNY-SCZZXKLOSA-N |
| XLogP | 0.10 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |