C22H26N4O — CID 50976029
2-[[5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-phenylimidazol-1-yl]methyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 50976029) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[[5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-phenylimidazol-1-yl]methyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[[5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-phenylimidazol-1-yl]methyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 50976029 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[[5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-phenylimidazol-1-yl]methyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | CC(C)=CCC/C(C)=C/c1c(-c2ccccc2)ncn1Cc1nnc(C)o1 |
| InChI | InChI=1S/C22H26N4O/c1-16(2)9-8-10-17(3)13-20-22(19-11-6-5-7-12-19)23-15-26(20)14-21-25-24-18(4)27-21/h5-7,9,11-13,15H,8,10,14H2,1-4H3/b17-13+ |
| InChIKey | BVOLWVCIMDBRRG-GHRIWEEISA-N |
| XLogP | 5.44 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|