About 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one
4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one (PubChem CID 50976295) has the molecular formula C15H27N5O
and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one |
| PubChem CID | 50976295 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one |
| SMILES | CN1CCN(Cc2n[nH]c(=O)n2CC2CCCCC2)CC1 |
| InChI | InChI=1S/C15H27N5O/c1-18-7-9-19(10-8-18)12-14-16-17-15(21)20(14)11-13-5-3-2-4-6-13/h13H,2-12H2,1H3,(H,17,21) |
| InChIKey | LLQFESYGIYROSM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one (CID 50976295) is 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one is CN1CCN(Cc2n[nH]c(=O)n2CC2CCCCC2)CC1.
What is the InChIKey of 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one?
The InChIKey is LLQFESYGIYROSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N5O/c1-18-7-9-19(10-8-18)12-14-16-17-15(21)20(14)11-13-5-3-2-4-6-13/h13H,2-12H2,1H3,(H,17,21).
What are the key properties of 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one?
4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one has a molecular weight of 293.41 g/mol, XLogP of 0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexylmethyl)-3-[(4-methylpiperazin-1-yl)methyl]-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 50976295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).