C24H54Si6 — CID 5097630
trimethyl-[1,1,4,6,6-pentakis(trimethylsilyl)hexa-1,2,4,5-tetraen-3-yl]silane (PubChem CID 5097630) has the molecular formula C24H54Si6 and a molecular weight of 511.21 g/mol. Its IUPAC name is trimethyl-[1,1,4,6,6-pentakis(trimethylsilyl)hexa-1,2,4,5-tetraen-3-yl]silane.
| Compound Name | trimethyl-[1,1,4,6,6-pentakis(trimethylsilyl)hexa-1,2,4,5-tetraen-3-yl]silane |
|---|---|
| PubChem CID | 5097630 |
| Molecular Formula | C24H54Si6 |
| Molecular Weight | 511.21 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | trimethyl-[1,1,4,6,6-pentakis(trimethylsilyl)hexa-1,2,4,5-tetraen-3-yl]silane |
| SMILES | C[Si](C)(C)C(=C=C([Si](C)(C)C)[Si](C)(C)C)C(=C=C([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H54Si6/c1-25(2,3)21(19-23(27(7,8)9)28(10,11)12)22(26(4,5)6)20-24(29(13,14)15)30(16,17)18/h1-18H3 |
| InChIKey | ZGWHURGNNFKCKU-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.21 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|