About 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide
6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 50976512) has the molecular formula C16H17Cl2N5O
and a molecular weight of 366.25 g/mol. Its IUPAC name is 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide |
| PubChem CID | 50976512 |
| Molecular Formula | C16H17Cl2N5O |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCN(Cc3c(Cl)cncc3Cl)CC2)nc1 |
| InChI | InChI=1S/C16H17Cl2N5O/c17-13-8-20-9-14(18)12(13)10-22-3-5-23(6-4-22)15-2-1-11(7-21-15)16(19)24/h1-2,7-9H,3-6,10H2,(H2,19,24) |
| InChIKey | IBBQPMATBNGFKX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide?
The IUPAC name of 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide (CID 50976512) is 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide.
What is the SMILES notation for 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide?
The canonical SMILES for 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide is NC(=O)c1ccc(N2CCN(Cc3c(Cl)cncc3Cl)CC2)nc1.
What is the InChIKey of 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide?
The InChIKey is IBBQPMATBNGFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2N5O/c17-13-8-20-9-14(18)12(13)10-22-3-5-23(6-4-22)15-2-1-11(7-21-15)16(19)24/h1-2,7-9H,3-6,10H2,(H2,19,24).
What are the key properties of 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide?
6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide has a molecular weight of 366.25 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[(3,5-dichloro-4-pyridinyl)methyl]piperazin-1-yl]pyridine-3-carboxamide is sourced from PubChem (CID 50976512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).