About N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine
N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine (PubChem CID 50976579) has the molecular formula C9H15N3O2S
and a molecular weight of 229.30 g/mol. Its IUPAC name is N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine.
Molecular Properties
| Compound Name | N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine |
| PubChem CID | 50976579 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine |
| SMILES | COCc1nc(CNC2CCSC2)no1 |
| InChI | InChI=1S/C9H15N3O2S/c1-13-5-9-11-8(12-14-9)4-10-7-2-3-15-6-7/h7,10H,2-6H2,1H3 |
| InChIKey | NQFWZPMPDFXMKK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine?
The IUPAC name of N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine (CID 50976579) is N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine.
What is the SMILES notation for N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine?
The canonical SMILES for N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine is COCc1nc(CNC2CCSC2)no1.
What is the InChIKey of N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine?
The InChIKey is NQFWZPMPDFXMKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-13-5-9-11-8(12-14-9)4-10-7-2-3-15-6-7/h7,10H,2-6H2,1H3.
What are the key properties of N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine?
N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine has a molecular weight of 229.30 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]methyl]thiolan-3-amine is sourced from PubChem (CID 50976579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).