About 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol
1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol (PubChem CID 50977518) has the molecular formula C16H23N5OS
and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol |
| PubChem CID | 50977518 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol |
| SMILES | CCCc1nc(CNc2nccc(N3CCC(O)CC3)n2)cs1 |
| InChI | InChI=1S/C16H23N5OS/c1-2-3-15-19-12(11-23-15)10-18-16-17-7-4-14(20-16)21-8-5-13(22)6-9-21/h4,7,11,13,22H,2-3,5-6,8-10H2,1H3,(H,17,18,20) |
| InChIKey | SSXDCAMBAIDHTJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol?
The IUPAC name of 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol (CID 50977518) is 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol.
What is the SMILES notation for 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol?
The canonical SMILES for 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol is CCCc1nc(CNc2nccc(N3CCC(O)CC3)n2)cs1.
What is the InChIKey of 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol?
The InChIKey is SSXDCAMBAIDHTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5OS/c1-2-3-15-19-12(11-23-15)10-18-16-17-7-4-14(20-16)21-8-5-13(22)6-9-21/h4,7,11,13,22H,2-3,5-6,8-10H2,1H3,(H,17,18,20).
What are the key properties of 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol?
1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol has a molecular weight of 333.46 g/mol, XLogP of 2.46, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2-propyl-1,3-thiazol-4-yl)methylamino]pyrimidin-4-yl]piperidin-4-ol is sourced from PubChem (CID 50977518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).