C19H30N6O — CID 50977618
(3aR,6aR)-5-cyclopentyl-N-methyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50977618) has the molecular formula C19H30N6O and a molecular weight of 358.49 g/mol. Its IUPAC name is (3aR,6aR)-5-cyclopentyl-N-methyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-5-cyclopentyl-N-methyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50977618 |
| Molecular Formula | C19H30N6O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (3aR,6aR)-5-cyclopentyl-N-methyl-N-[[2-(methylamino)pyrimidin-5-yl]methyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | CNc1ncc(CN(C)C(=O)[C@@]23CNC[C@@H]2CN(C2CCCC2)C3)cn1 |
| InChI | InChI=1S/C19H30N6O/c1-20-18-22-7-14(8-23-18)10-24(2)17(26)19-12-21-9-15(19)11-25(13-19)16-5-3-4-6-16/h7-8,15-16,21H,3-6,9-13H2,1-2H3,(H,20,22,23)/t15-,19-/m1/s1 |
| InChIKey | ZKSXDQDGLYEYRL-DNVCBOLYSA-N |
| XLogP | 0.94 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |