C16H24N4O4 — CID 50977850
(3aR,6aR)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(2-methoxyacetyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50977850) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (3aR,6aR)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(2-methoxyacetyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(2-methoxyacetyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50977850 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (3aR,6aR)-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-(2-methoxyacetyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | COCC(=O)N1C[C@H]2CNC[C@@]2(C(=O)NCc2c(C)noc2C)C1 |
| InChI | InChI=1S/C16H24N4O4/c1-10-13(11(2)24-19-10)5-18-15(22)16-8-17-4-12(16)6-20(9-16)14(21)7-23-3/h12,17H,4-9H2,1-3H3,(H,18,22)/t12-,16-/m1/s1 |
| InChIKey | QUYWLZGOONXZFM-MLGOLLRUSA-N |
| XLogP | -0.40 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |