About 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide
1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 50978391) has the molecular formula C15H25N5O2S
and a molecular weight of 339.47 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide |
| PubChem CID | 50978391 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | CC(C)c1nnsc1CNC(=O)C1CCCN(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C15H25N5O2S/c1-10(2)13-12(23-18-17-13)8-16-14(21)11-6-5-7-20(9-11)15(22)19(3)4/h10-11H,5-9H2,1-4H3,(H,16,21) |
| InChIKey | BWJWPAQHTGBMRF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide?
The IUPAC name of 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide (CID 50978391) is 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide.
What is the SMILES notation for 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide?
The canonical SMILES for 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide is CC(C)c1nnsc1CNC(=O)C1CCCN(C(=O)N(C)C)C1.
What is the InChIKey of 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide?
The InChIKey is BWJWPAQHTGBMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5O2S/c1-10(2)13-12(23-18-17-13)8-16-14(21)11-6-5-7-20(9-11)15(22)19(3)4/h10-11H,5-9H2,1-4H3,(H,16,21).
What are the key properties of 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide?
1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide has a molecular weight of 339.47 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-dimethyl-3-N-[(4-propan-2-ylthiadiazol-5-yl)methyl]piperidine-1,3-dicarboxamide is sourced from PubChem (CID 50978391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).