About N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine
N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine (PubChem CID 50978544) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine |
| PubChem CID | 50978544 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine |
| SMILES | COCC(C)NCCNc1cc(C)ccn1 |
| InChI | InChI=1S/C12H21N3O/c1-10-4-5-14-12(8-10)15-7-6-13-11(2)9-16-3/h4-5,8,11,13H,6-7,9H2,1-3H3,(H,14,15) |
| InChIKey | XTPUHUOZEAHESK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine?
The IUPAC name of N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine (CID 50978544) is N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine?
The canonical SMILES for N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine is COCC(C)NCCNc1cc(C)ccn1.
What is the InChIKey of N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine?
The InChIKey is XTPUHUOZEAHESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O/c1-10-4-5-14-12(8-10)15-7-6-13-11(2)9-16-3/h4-5,8,11,13H,6-7,9H2,1-3H3,(H,14,15).
What are the key properties of N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine?
N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine has a molecular weight of 223.32 g/mol, XLogP of 1.43, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-methoxypropan-2-yl)-N-(4-methyl-2-pyridinyl)ethane-1,2-diamine is sourced from PubChem (CID 50978544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).