C16H25N3O — CID 50978557
7-[(E)-hex-2-enyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one (PubChem CID 50978557) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 7-[(E)-hex-2-enyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one.
| Compound Name | 7-[(E)-hex-2-enyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 50978557 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 7-[(E)-hex-2-enyl]-2,3-dimethyl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-one |
| SMILES | CCC/C=C/CN1CCc2nc(C)n(C)c(=O)c2CC1 |
| InChI | InChI=1S/C16H25N3O/c1-4-5-6-7-10-19-11-8-14-15(9-12-19)17-13(2)18(3)16(14)20/h6-7H,4-5,8-12H2,1-3H3/b7-6+ |
| InChIKey | ROJPEGBWUPBHIW-VOTSOKGWSA-N |
| XLogP | 1.85 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|