About 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine
5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine (PubChem CID 50978867) has the molecular formula C14H22N6
and a molecular weight of 274.37 g/mol. Its IUPAC name is 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine |
| PubChem CID | 50978867 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine |
| SMILES | CCc1cnc(C)nc1NC(CC)c1ncnn1CC |
| InChI | InChI=1S/C14H22N6/c1-5-11-8-15-10(4)18-13(11)19-12(6-2)14-16-9-17-20(14)7-3/h8-9,12H,5-7H2,1-4H3,(H,15,18,19) |
| InChIKey | FTFHBUAMXYKSJO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine?
The IUPAC name of 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine (CID 50978867) is 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine.
What is the SMILES notation for 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine?
The canonical SMILES for 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine is CCc1cnc(C)nc1NC(CC)c1ncnn1CC.
What is the InChIKey of 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine?
The InChIKey is FTFHBUAMXYKSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N6/c1-5-11-8-15-10(4)18-13(11)19-12(6-2)14-16-9-17-20(14)7-3/h8-9,12H,5-7H2,1-4H3,(H,15,18,19).
What are the key properties of 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine?
5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine has a molecular weight of 274.37 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N-[1-(2-ethyl-1,2,4-triazol-3-yl)propyl]-2-methylpyrimidin-4-amine is sourced from PubChem (CID 50978867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).