C13H20F3NOS — CID 50978911
2-[thiophen-3-ylmethyl(4,4,4-trifluorobutyl)amino]butan-1-ol (PubChem CID 50978911) has the molecular formula C13H20F3NOS and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-[thiophen-3-ylmethyl(4,4,4-trifluorobutyl)amino]butan-1-ol.
| Compound Name | 2-[thiophen-3-ylmethyl(4,4,4-trifluorobutyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 50978911 |
| Molecular Formula | C13H20F3NOS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[thiophen-3-ylmethyl(4,4,4-trifluorobutyl)amino]butan-1-ol |
| SMILES | CCC(CO)N(CCCC(F)(F)F)Cc1ccsc1 |
| InChI | InChI=1S/C13H20F3NOS/c1-2-12(9-18)17(6-3-5-13(14,15)16)8-11-4-7-19-10-11/h4,7,10,12,18H,2-3,5-6,8-9H2,1H3 |
| InChIKey | QFTAONOKQYVESX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |