C15H22FN3O4S — CID 50979216
N-[(2-fluorophenyl)methyl]-2-[(4-methylsulfonylmorpholin-2-yl)methylamino]acetamide (PubChem CID 50979216) has the molecular formula C15H22FN3O4S and a molecular weight of 359.42 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-[(4-methylsulfonylmorpholin-2-yl)methylamino]acetamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-[(4-methylsulfonylmorpholin-2-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 50979216 |
| Molecular Formula | C15H22FN3O4S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-[(4-methylsulfonylmorpholin-2-yl)methylamino]acetamide |
| SMILES | CS(=O)(=O)N1CCOC(CNCC(=O)NCc2ccccc2F)C1 |
| InChI | InChI=1S/C15H22FN3O4S/c1-24(21,22)19-6-7-23-13(11-19)9-17-10-15(20)18-8-12-4-2-3-5-14(12)16/h2-5,13,17H,6-11H2,1H3,(H,18,20) |
| InChIKey | OENKTJPKIBVNRB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |