About 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole
4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole (PubChem CID 50979592) has the molecular formula C20H22N6
and a molecular weight of 346.44 g/mol. Its IUPAC name is 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 50979592 |
| Molecular Formula | C20H22N6 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole |
| SMILES | CCn1ccnc1Cn1cnc(-c2ccccc2)c1-c1c(C)n[nH]c1C |
| InChI | InChI=1S/C20H22N6/c1-4-25-11-10-21-17(25)12-26-13-22-19(16-8-6-5-7-9-16)20(26)18-14(2)23-24-15(18)3/h5-11,13H,4,12H2,1-3H3,(H,23,24) |
| InChIKey | VPCUNKAGWNDYSE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole (CID 50979592) is 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole is CCn1ccnc1Cn1cnc(-c2ccccc2)c1-c1c(C)n[nH]c1C.
What is the InChIKey of 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole?
The InChIKey is VPCUNKAGWNDYSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N6/c1-4-25-11-10-21-17(25)12-26-13-22-19(16-8-6-5-7-9-16)20(26)18-14(2)23-24-15(18)3/h5-11,13H,4,12H2,1-3H3,(H,23,24).
What are the key properties of 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole?
4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole has a molecular weight of 346.44 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(1-ethylimidazol-2-yl)methyl]-5-phenylimidazol-4-yl]-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 50979592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).