C22H26N2O3 — CID 50979607
methyl 2-[(1-benzoylpiperidin-4-yl)amino]-2-(3-methylphenyl)acetate (PubChem CID 50979607) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is methyl 2-[(1-benzoylpiperidin-4-yl)amino]-2-(3-methylphenyl)acetate.
| Compound Name | methyl 2-[(1-benzoylpiperidin-4-yl)amino]-2-(3-methylphenyl)acetate |
|---|---|
| PubChem CID | 50979607 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | methyl 2-[(1-benzoylpiperidin-4-yl)amino]-2-(3-methylphenyl)acetate |
| SMILES | COC(=O)C(NC1CCN(C(=O)c2ccccc2)CC1)c1cccc(C)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-16-7-6-10-18(15-16)20(22(26)27-2)23-19-11-13-24(14-12-19)21(25)17-8-4-3-5-9-17/h3-10,15,19-20,23H,11-14H2,1-2H3 |
| InChIKey | VJRFDQIVKLRLGS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |