C11H21NO2 — CID 50980110
2-[1-(cyclohexen-1-yl)ethylamino]propane-1,3-diol (PubChem CID 50980110) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-[1-(cyclohexen-1-yl)ethylamino]propane-1,3-diol.
| Compound Name | 2-[1-(cyclohexen-1-yl)ethylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 50980110 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-[1-(cyclohexen-1-yl)ethylamino]propane-1,3-diol |
| SMILES | CC(NC(CO)CO)C1=CCCCC1 |
| InChI | InChI=1S/C11H21NO2/c1-9(12-11(7-13)8-14)10-5-3-2-4-6-10/h5,9,11-14H,2-4,6-8H2,1H3 |
| InChIKey | SVYZKVNPSJIHJL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|