C19H32N4O3 — CID 50980850
(3aR,6aR)-5-(cyclopropanecarbonyl)-N-(2-methyl-1-morpholin-4-ylpropan-2-yl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 50980850) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3aR,6aR)-5-(cyclopropanecarbonyl)-N-(2-methyl-1-morpholin-4-ylpropan-2-yl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-5-(cyclopropanecarbonyl)-N-(2-methyl-1-morpholin-4-ylpropan-2-yl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 50980850 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (3aR,6aR)-5-(cyclopropanecarbonyl)-N-(2-methyl-1-morpholin-4-ylpropan-2-yl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | CC(C)(CN1CCOCC1)NC(=O)[C@@]12CNC[C@@H]1CN(C(=O)C1CC1)C2 |
| InChI | InChI=1S/C19H32N4O3/c1-18(2,12-22-5-7-26-8-6-22)21-17(25)19-11-20-9-15(19)10-23(13-19)16(24)14-3-4-14/h14-15,20H,3-13H2,1-2H3,(H,21,25)/t15-,19-/m1/s1 |
| InChIKey | JGFDJLPCRFIGIV-DNVCBOLYSA-N |
| XLogP | -0.33 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |