C19H24N4O4 — CID 50981196
3-[[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]methylamino]-1-(3-methylpiperidin-1-yl)propan-1-one (PubChem CID 50981196) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]methylamino]-1-(3-methylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-[[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]methylamino]-1-(3-methylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 50981196 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[[5-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-3-yl]methylamino]-1-(3-methylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CCCN(C(=O)CCNCc2noc(-c3ccc4c(c3)OCO4)n2)C1 |
| InChI | InChI=1S/C19H24N4O4/c1-13-3-2-8-23(11-13)18(24)6-7-20-10-17-21-19(27-22-17)14-4-5-15-16(9-14)26-12-25-15/h4-5,9,13,20H,2-3,6-8,10-12H2,1H3 |
| InChIKey | PKWZQFTWVVPESE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|