C16H25FN4O3 — CID 50981741
[4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-methylamino]methyl]oxan-4-yl]methanol (PubChem CID 50981741) has the molecular formula C16H25FN4O3 and a molecular weight of 340.40 g/mol. Its IUPAC name is [4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-methylamino]methyl]oxan-4-yl]methanol.
| Compound Name | [4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-methylamino]methyl]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 50981741 |
| Molecular Formula | C16H25FN4O3 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [4-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-methylamino]methyl]oxan-4-yl]methanol |
| SMILES | CN(CC1(CO)CCOCC1)c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H25FN4O3/c1-20(11-16(12-22)2-6-23-7-3-16)15-18-10-13(17)14(19-15)21-4-8-24-9-5-21/h10,22H,2-9,11-12H2,1H3 |
| InChIKey | QQKPYLRCXZFSNP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |