C16H19ClN2O3 — CID 50982108
N-[[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide (PubChem CID 50982108) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is N-[[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide.
| Compound Name | N-[[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 50982108 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[[1-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-3,6-dihydro-2H-pyridin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1=CCCN(Cc2cc3c(cc2Cl)OCO3)C1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-11(20)18-7-12-3-2-4-19(8-12)9-13-5-15-16(6-14(13)17)22-10-21-15/h3,5-6H,2,4,7-10H2,1H3,(H,18,20) |
| InChIKey | MLBUKWZZOQJFRC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|