C6H6N4S — CID 5098240
8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione (PubChem CID 5098240) has the molecular formula C6H6N4S and a molecular weight of 166.21 g/mol. Its IUPAC name is 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione.
| Compound Name | 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione |
|---|---|
| PubChem CID | 5098240 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 8-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione |
| SMILES | Cc1cc(=S)[nH]n2cnnc12 |
| InChI | InChI=1S/C6H6N4S/c1-4-2-5(11)9-10-3-7-8-6(4)10/h2-3H,1H3,(H,9,11) |
| InChIKey | ZVVYSRBCWWTVML-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|