About 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine
3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine (PubChem CID 50982987) has the molecular formula C19H26N4
and a molecular weight of 310.45 g/mol. Its IUPAC name is 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine.
Molecular Properties
| Compound Name | 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine |
| PubChem CID | 50982987 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine |
| SMILES | Cc1cnc(C)c(N2CCN(Cc3ccc(C)c(C)c3)CC2)n1 |
| InChI | InChI=1S/C19H26N4/c1-14-5-6-18(11-15(14)2)13-22-7-9-23(10-8-22)19-17(4)20-12-16(3)21-19/h5-6,11-12H,7-10,13H2,1-4H3 |
| InChIKey | XNTDQSFFPRIXRG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine?
The IUPAC name of 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine (CID 50982987) is 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine.
What is the SMILES notation for 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine?
The canonical SMILES for 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine is Cc1cnc(C)c(N2CCN(Cc3ccc(C)c(C)c3)CC2)n1.
What is the InChIKey of 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine?
The InChIKey is XNTDQSFFPRIXRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4/c1-14-5-6-18(11-15(14)2)13-22-7-9-23(10-8-22)19-17(4)20-12-16(3)21-19/h5-6,11-12H,7-10,13H2,1-4H3.
What are the key properties of 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine?
3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine has a molecular weight of 310.45 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]-2,5-dimethylpyrazine is sourced from PubChem (CID 50982987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).