About 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide
1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 50983903) has the molecular formula C14H25N5O
and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide |
| PubChem CID | 50983903 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | CCN1CCCC(C)(C(=O)NCCCn2cncn2)C1 |
| InChI | InChI=1S/C14H25N5O/c1-3-18-8-4-6-14(2,10-18)13(20)16-7-5-9-19-12-15-11-17-19/h11-12H,3-10H2,1-2H3,(H,16,20) |
| InChIKey | KHDXJEXFBOFXAO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide?
The IUPAC name of 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide (CID 50983903) is 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide.
What is the SMILES notation for 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide?
The canonical SMILES for 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide is CCN1CCCC(C)(C(=O)NCCCn2cncn2)C1.
What is the InChIKey of 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide?
The InChIKey is KHDXJEXFBOFXAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N5O/c1-3-18-8-4-6-14(2,10-18)13(20)16-7-5-9-19-12-15-11-17-19/h11-12H,3-10H2,1-2H3,(H,16,20).
What are the key properties of 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide?
1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide has a molecular weight of 279.39 g/mol, XLogP of 0.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-N-[3-(1,2,4-triazol-1-yl)propyl]piperidine-3-carboxamide is sourced from PubChem (CID 50983903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).