About N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine
N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine (PubChem CID 50984490) has the molecular formula C15H18N4O2
and a molecular weight of 286.33 g/mol. Its IUPAC name is N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine |
| PubChem CID | 50984490 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine |
| SMILES | CCCCN(Cc1ccco1)c1ncnc2oc(C)nc12 |
| InChI | InChI=1S/C15H18N4O2/c1-3-4-7-19(9-12-6-5-8-20-12)14-13-15(17-10-16-14)21-11(2)18-13/h5-6,8,10H,3-4,7,9H2,1-2H3 |
| InChIKey | ZAQIHJVYSUXQDT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The IUPAC name of N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine (CID 50984490) is N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine.
What is the SMILES notation for N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The canonical SMILES for N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine is CCCCN(Cc1ccco1)c1ncnc2oc(C)nc12.
What is the InChIKey of N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The InChIKey is ZAQIHJVYSUXQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2/c1-3-4-7-19(9-12-6-5-8-20-12)14-13-15(17-10-16-14)21-11(2)18-13/h5-6,8,10H,3-4,7,9H2,1-2H3.
What are the key properties of N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine has a molecular weight of 286.33 g/mol, XLogP of 3.33, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(furan-2-ylmethyl)-2-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine is sourced from PubChem (CID 50984490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).