C15H27FN4O — CID 50984828
4-ethyl-2-(5-fluoropentyl)-5-(piperidin-4-ylmethyl)-1,2,4-triazol-3-one (PubChem CID 50984828) has the molecular formula C15H27FN4O and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-ethyl-2-(5-fluoropentyl)-5-(piperidin-4-ylmethyl)-1,2,4-triazol-3-one.
| Compound Name | 4-ethyl-2-(5-fluoropentyl)-5-(piperidin-4-ylmethyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 50984828 |
| Molecular Formula | C15H27FN4O |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 4-ethyl-2-(5-fluoropentyl)-5-(piperidin-4-ylmethyl)-1,2,4-triazol-3-one |
| SMILES | CCn1c(CC2CCNCC2)nn(CCCCCF)c1=O |
| InChI | InChI=1S/C15H27FN4O/c1-2-19-14(12-13-6-9-17-10-7-13)18-20(15(19)21)11-5-3-4-8-16/h13,17H,2-12H2,1H3 |
| InChIKey | BYCVOFFERKOIQZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|