C17H21N5O3S — CID 50984940
methyl 2-[[2-(3-cyclopropyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 50984940) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is methyl 2-[[2-(3-cyclopropyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[[2-(3-cyclopropyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 50984940 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | methyl 2-[[2-(3-cyclopropyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)CN2CCc3[nH]nc(C4CC4)c3C2)nc1C |
| InChI | InChI=1S/C17H21N5O3S/c1-9-15(16(24)25-2)26-17(18-9)19-13(23)8-22-6-5-12-11(7-22)14(21-20-12)10-3-4-10/h10H,3-8H2,1-2H3,(H,20,21)(H,18,19,23) |
| InChIKey | NDQQTKVNJXTCEZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |