C16H28N4O3 — CID 50985000
2-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 50985000) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 50985000 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | COCCN1CCC(CN2CCN3C(=O)CNC(=O)C3C2)CC1 |
| InChI | InChI=1S/C16H28N4O3/c1-23-9-8-18-4-2-13(3-5-18)11-19-6-7-20-14(12-19)16(22)17-10-15(20)21/h13-14H,2-12H2,1H3,(H,17,22) |
| InChIKey | LMBFLDTZTWPMTM-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |