C16H25N3O3 — CID 50985145
2,2-dimethylpropyl 2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate (PubChem CID 50985145) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate.
| Compound Name | 2,2-dimethylpropyl 2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 50985145 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2,2-dimethylpropyl 2,3-dimethyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
| SMILES | Cc1nc2c(c(=O)n1C)CCN(C(=O)OCC(C)(C)C)CC2 |
| InChI | InChI=1S/C16H25N3O3/c1-11-17-13-7-9-19(15(21)22-10-16(2,3)4)8-6-12(13)14(20)18(11)5/h6-10H2,1-5H3 |
| InChIKey | KVGZXKUWYPNSCF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |