About ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate
ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate (PubChem CID 50985175) has the molecular formula C16H26N4O3
and a molecular weight of 322.41 g/mol. Its IUPAC name is ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate |
| PubChem CID | 50985175 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCCn2c(C)cc(C)nc2=O)CC1 |
| InChI | InChI=1S/C16H26N4O3/c1-4-23-16(22)19-8-5-14(6-9-19)17-7-10-20-13(3)11-12(2)18-15(20)21/h11,14,17H,4-10H2,1-3H3 |
| InChIKey | UWEXKVWQDMZGJF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate (CID 50985175) is ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate is CCOC(=O)N1CCC(NCCn2c(C)cc(C)nc2=O)CC1.
What is the InChIKey of ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate?
The InChIKey is UWEXKVWQDMZGJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O3/c1-4-23-16(22)19-8-5-14(6-9-19)17-7-10-20-13(3)11-12(2)18-15(20)21/h11,14,17H,4-10H2,1-3H3.
What are the key properties of ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate?
ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate has a molecular weight of 322.41 g/mol, XLogP of 1.07, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethylamino]piperidine-1-carboxylate is sourced from PubChem (CID 50985175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).