C18H21NO2S2 — CID 50985347
(3S,4R)-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-4-(3-methylthiophen-2-yl)piperidin-3-ol (PubChem CID 50985347) has the molecular formula C18H21NO2S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is (3S,4R)-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-4-(3-methylthiophen-2-yl)piperidin-3-ol.
| Compound Name | (3S,4R)-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-4-(3-methylthiophen-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 50985347 |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (3S,4R)-1-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-4-(3-methylthiophen-2-yl)piperidin-3-ol |
| SMILES | Cc1ccsc1[C@@H]1CCN(Cc2cc(C#CCO)cs2)C[C@H]1O |
| InChI | InChI=1S/C18H21NO2S2/c1-13-5-8-22-18(13)16-4-6-19(11-17(16)21)10-15-9-14(12-23-15)3-2-7-20/h5,8-9,12,16-17,20-21H,4,6-7,10-11H2,1H3/t16-,17-/m1/s1 |
| InChIKey | GODVMQAGVIOUMM-IAGOWNOFSA-N |
| XLogP | 2.81 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|