About N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine
N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine (PubChem CID 50985542) has the molecular formula C18H15N5O2
and a molecular weight of 333.35 g/mol. Its IUPAC name is N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine |
| PubChem CID | 50985542 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine |
| SMILES | Cc1cc(NCc2cc(-c3ccco3)on2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C18H15N5O2/c1-12-8-17(22-18(21-12)13-4-2-6-19-10-13)20-11-14-9-16(25-23-14)15-5-3-7-24-15/h2-10H,11H2,1H3,(H,20,21,22) |
| InChIKey | OJHCRPSCGFGRHP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine?
The IUPAC name of N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine (CID 50985542) is N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine.
What is the SMILES notation for N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine?
The canonical SMILES for N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine is Cc1cc(NCc2cc(-c3ccco3)on2)nc(-c2cccnc2)n1.
What is the InChIKey of N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine?
The InChIKey is OJHCRPSCGFGRHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O2/c1-12-8-17(22-18(21-12)13-4-2-6-19-10-13)20-11-14-9-16(25-23-14)15-5-3-7-24-15/h2-10H,11H2,1H3,(H,20,21,22).
What are the key properties of N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine?
N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine has a molecular weight of 333.35 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-6-methyl-2-pyridin-3-ylpyrimidin-4-amine is sourced from PubChem (CID 50985542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).