About 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine
4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine (PubChem CID 50985549) has the molecular formula C17H26N2O4S
and a molecular weight of 354.47 g/mol. Its IUPAC name is 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine |
| PubChem CID | 50985549 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine |
| SMILES | CS(=O)(=O)Cc1ccc(C[C@@H]2CC[C@H](CN3CCOCC3)O2)nc1 |
| InChI | InChI=1S/C17H26N2O4S/c1-24(20,21)13-14-2-3-15(18-11-14)10-16-4-5-17(23-16)12-19-6-8-22-9-7-19/h2-3,11,16-17H,4-10,12-13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | WJVCAHNJHRUCBY-DLBZAZTESA-N |
| XLogP | 1.05 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine?
The IUPAC name of 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine (CID 50985549) is 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine is CS(=O)(=O)Cc1ccc(C[C@@H]2CC[C@H](CN3CCOCC3)O2)nc1.
What is the InChIKey of 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine?
The InChIKey is WJVCAHNJHRUCBY-DLBZAZTESA-N. The full InChI is InChI=1S/C17H26N2O4S/c1-24(20,21)13-14-2-3-15(18-11-14)10-16-4-5-17(23-16)12-19-6-8-22-9-7-19/h2-3,11,16-17H,4-10,12-13H2,1H3/t16-,17+/m0/s1.
What are the key properties of 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine?
4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine has a molecular weight of 354.47 g/mol, XLogP of 1.05, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R,5S)-5-[[5-(methylsulfonylmethyl)-2-pyridinyl]methyl]oxolan-2-yl]methyl]morpholine is sourced from PubChem (CID 50985549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).