About (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate
(2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 50985733) has the molecular formula C16H16Cl2O3
and a molecular weight of 327.21 g/mol. Its IUPAC name is (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate.
Molecular Properties
| Compound Name | (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate |
| PubChem CID | 50985733 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1Cl)C1C[C@H]2CCC[C@H](C1)C2=O |
| InChI | InChI=1S/C16H16Cl2O3/c17-12-5-2-6-13(14(12)18)21-16(20)11-7-9-3-1-4-10(8-11)15(9)19/h2,5-6,9-11H,1,3-4,7-8H2/t9-,10-/m1/s1 |
| InChIKey | CNVHDMRQQBKGJZ-NXEZZACHSA-N |
| XLogP | 4.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate?
The IUPAC name of (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate (CID 50985733) is (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate.
What is the SMILES notation for (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate?
The canonical SMILES for (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate is O=C(Oc1cccc(Cl)c1Cl)C1C[C@H]2CCC[C@H](C1)C2=O.
What is the InChIKey of (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate?
The InChIKey is CNVHDMRQQBKGJZ-NXEZZACHSA-N. The full InChI is InChI=1S/C16H16Cl2O3/c17-12-5-2-6-13(14(12)18)21-16(20)11-7-9-3-1-4-10(8-11)15(9)19/h2,5-6,9-11H,1,3-4,7-8H2/t9-,10-/m1/s1.
What are the key properties of (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate?
(2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate has a molecular weight of 327.21 g/mol, XLogP of 4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichlorophenyl) (1R,5R)-9-oxobicyclo[3.3.1]nonane-3-carboxylate is sourced from PubChem (CID 50985733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).