C24H30N2O3 — CID 50985943
5-butyl-4-(3,4-dimethoxyphenyl)-1-[2-(2-methoxyphenyl)ethyl]imidazole (PubChem CID 50985943) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 5-butyl-4-(3,4-dimethoxyphenyl)-1-[2-(2-methoxyphenyl)ethyl]imidazole.
| Compound Name | 5-butyl-4-(3,4-dimethoxyphenyl)-1-[2-(2-methoxyphenyl)ethyl]imidazole |
|---|---|
| PubChem CID | 50985943 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 5-butyl-4-(3,4-dimethoxyphenyl)-1-[2-(2-methoxyphenyl)ethyl]imidazole |
| SMILES | CCCCc1c(-c2ccc(OC)c(OC)c2)ncn1CCc1ccccc1OC |
| InChI | InChI=1S/C24H30N2O3/c1-5-6-10-20-24(19-12-13-22(28-3)23(16-19)29-4)25-17-26(20)15-14-18-9-7-8-11-21(18)27-2/h7-9,11-13,16-17H,5-6,10,14-15H2,1-4H3 |
| InChIKey | JEJHGXQYWSTRQI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |