About 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione
5,6-diamino-1,3-dipropylpyrimidine-2,4-dione (PubChem CID 5098605) has the molecular formula C10H18N4O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione |
| PubChem CID | 5098605 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione |
| SMILES | CCCn1c(N)c(N)c(=O)n(CCC)c1=O |
| InChI | InChI=1S/C10H18N4O2/c1-3-5-13-8(12)7(11)9(15)14(6-4-2)10(13)16/h3-6,11-12H2,1-2H3 |
| InChIKey | SVMBOONGPUFHRA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione?
The IUPAC name of 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione (CID 5098605) is 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione.
What is the SMILES notation for 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione?
The canonical SMILES for 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione is CCCn1c(N)c(N)c(=O)n(CCC)c1=O.
What is the InChIKey of 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione?
The InChIKey is SVMBOONGPUFHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2/c1-3-5-13-8(12)7(11)9(15)14(6-4-2)10(13)16/h3-6,11-12H2,1-2H3.
What are the key properties of 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione?
5,6-diamino-1,3-dipropylpyrimidine-2,4-dione has a molecular weight of 226.28 g/mol, XLogP of -0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diamino-1,3-dipropylpyrimidine-2,4-dione is sourced from PubChem (CID 5098605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).