C19H19F3N4O2 — CID 5098623
9-(2-methoxyphenyl)-6,6-dimethyl-2-(trifluoromethyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 5098623) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 9-(2-methoxyphenyl)-6,6-dimethyl-2-(trifluoromethyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(2-methoxyphenyl)-6,6-dimethyl-2-(trifluoromethyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 5098623 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 9-(2-methoxyphenyl)-6,6-dimethyl-2-(trifluoromethyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccccc1C1C2=C(CC(C)(C)CC2=O)Nc2nc(C(F)(F)F)nn21 |
| InChI | InChI=1S/C19H19F3N4O2/c1-18(2)8-11-14(12(27)9-18)15(10-6-4-5-7-13(10)28-3)26-17(23-11)24-16(25-26)19(20,21)22/h4-7,15H,8-9H2,1-3H3,(H,23,24,25) |
| InChIKey | QAPKHIOHKPOLLY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |