C6H12N4 — CID 50986546
2-methyl-5-propan-2-yl-1,2,4-triazol-3-amine (PubChem CID 50986546) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-methyl-5-propan-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 2-methyl-5-propan-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 50986546 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 2-methyl-5-propan-2-yl-1,2,4-triazol-3-amine |
| SMILES | CC(C)c1nc(N)n(C)n1 |
| InChI | InChI=1S/C6H12N4/c1-4(2)5-8-6(7)10(3)9-5/h4H,1-3H3,(H2,7,8,9) |
| InChIKey | VCTVUJOTOJYMIS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |