About hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride
hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride (PubChem CID 50986722) has the molecular formula C11H16ClNS
and a molecular weight of 229.78 g/mol. Its IUPAC name is hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride.
Molecular Properties
| Compound Name | hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride |
| PubChem CID | 50986722 |
| Molecular Formula | C11H16ClNS |
| Molecular Weight | 229.78 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride |
| SMILES | Cc1ccc(C2NCCCS2)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C11H15NS.ClH/c1-9-3-5-10(6-4-9)11-12-7-2-8-13-11;/h3-6,11-12H,2,7-8H2,1H3;1H |
| InChIKey | RCUPVGZJNJUENQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.78 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride?
The IUPAC name of hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride (CID 50986722) is hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride.
What is the SMILES notation for hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride?
The canonical SMILES for hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride is Cc1ccc(C2NCCCS2)cc1.[Cl-].[H+].
What is the InChIKey of hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride?
The InChIKey is RCUPVGZJNJUENQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS.ClH/c1-9-3-5-10(6-4-9)11-12-7-2-8-13-11;/h3-6,11-12H,2,7-8H2,1H3;1H.
What are the key properties of hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride?
hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride has a molecular weight of 229.78 g/mol, XLogP of -0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-(4-methylphenyl)-1,3-thiazinane;chloride is sourced from PubChem (CID 50986722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).