About [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride
[2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride (PubChem CID 50986773) has the molecular formula C19H31ClN2O3
and a molecular weight of 370.92 g/mol. Its IUPAC name is [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride.
Molecular Properties
| Compound Name | [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride |
| PubChem CID | 50986773 |
| Molecular Formula | C19H31ClN2O3 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride |
| SMILES | CCCCNc1ccc(C(=O)OC2CCCCC2N(C)C)c(O)c1.[Cl-].[H+] |
| InChI | InChI=1S/C19H30N2O3.ClH/c1-4-5-12-20-14-10-11-15(17(22)13-14)19(23)24-18-9-7-6-8-16(18)21(2)3;/h10-11,13,16,18,20,22H,4-9,12H2,1-3H3;1H |
| InChIKey | NNGFEYGTPUQMBQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride?
The IUPAC name of [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride (CID 50986773) is [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride.
What is the SMILES notation for [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride?
The canonical SMILES for [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride is CCCCNc1ccc(C(=O)OC2CCCCC2N(C)C)c(O)c1.[Cl-].[H+].
What is the InChIKey of [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride?
The InChIKey is NNGFEYGTPUQMBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O3.ClH/c1-4-5-12-20-14-10-11-15(17(22)13-14)19(23)24-18-9-7-6-8-16(18)21(2)3;/h10-11,13,16,18,20,22H,4-9,12H2,1-3H3;1H.
What are the key properties of [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride?
[2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride has a molecular weight of 370.92 g/mol, XLogP of 0.75, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylamino)cyclohexyl] 4-(butylamino)-2-hydroxybenzoate;hydron;chloride is sourced from PubChem (CID 50986773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).