C25H29ClN2O3 — CID 50986831
2-[2-(diethylamino)ethoxy]-N-(2-phenoxyphenyl)benzamide;hydron;chloride (PubChem CID 50986831) has the molecular formula C25H29ClN2O3 and a molecular weight of 440.97 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethoxy]-N-(2-phenoxyphenyl)benzamide;hydron;chloride.
| Compound Name | 2-[2-(diethylamino)ethoxy]-N-(2-phenoxyphenyl)benzamide;hydron;chloride |
|---|---|
| PubChem CID | 50986831 |
| Molecular Formula | C25H29ClN2O3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]-N-(2-phenoxyphenyl)benzamide;hydron;chloride |
| SMILES | CCN(CC)CCOc1ccccc1C(=O)Nc1ccccc1Oc1ccccc1.[Cl-].[H+] |
| InChI | InChI=1S/C25H28N2O3.ClH/c1-3-27(4-2)18-19-29-23-16-10-8-14-21(23)25(28)26-22-15-9-11-17-24(22)30-20-12-6-5-7-13-20;/h5-17H,3-4,18-19H2,1-2H3,(H,26,28);1H |
| InChIKey | CJXIXFAUUUBNON-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |